5. Give the products of the following reactions. a) NC-C6H4-OH + Br2/FeBr3 -> RING DEACTIVATED b) F3C-C6H4-COOH + Cl2/AlCl3 -> CARBOXYLIC ACID DEACTIVATES RING c) Cl-C6H4-NO2 + Ethanoyl Chloride/AlCl3 -> RING DEACTIVATED BY NO2 d) C6H4(SO3H)(N(CH3)(CH2CH3)) + Br2/FeBr3 -> DEACTIVATES RING e) C6H4(OH) + 2-methyl-1-propene / dil. H2SO4 f) CH3-C6H4-CHO + H2SO4/HNO3 -> DEACTIVATES RING
Added by Jacob B.
Close
Step 1
To generate a step-by-step solution, follow these steps: Show more…
Show all steps
Your feedback will help us improve your experience
Madhur L and 90 other Chemistry 101 educators are ready to help you.
Ask a new question
Labs
Want to see this concept in action?
Explore this concept interactively to see how it behaves as you change inputs.
Key Concepts
Recommended Videos
a) propanal + ? → dimetoksi propan b) 2-b%utanon + NaBH4 → ? c) 2-propanon + 2Zn + 4HCl → ? + 2ZnCl2 + H2O d) propanal + ? → CH3CH2C(=O)OH e) CH3CH2CH2Br + KOH → ? + ? f) ? + ? → H2SO4 → CH3C(=O)OCH2CH3 + H2O g) ? + ? → ? → H-C(=O)OH + H3C-C(CH3)2-CH2OH
Madhur L.
Aromatic Mechanism Analysis and the Reaction of "Pentane" with Ethanol The reaction between pentane and ethanol is known as the esterification reaction. It involves the conversion of an alcohol (ethanol) and an acid (pentane) into an ester (ethyl pentanoate) and water. This reaction is commonly used in the production of various esters for use in perfumes, flavorings, and solvents. The esterification reaction is typically carried out in the presence of a catalyst, such as sulfuric acid or a strong acid resin. The catalyst helps to speed up the reaction and increase the yield of the desired ester product. The reaction is also reversible, meaning that the ester can be converted back into the alcohol and acid under certain conditions. The reaction between pentane and ethanol can be represented by the following equation: pentane + ethanol ⇌ ethyl pentanoate + water In this reaction, the alcohol (ethanol) reacts with the acid (pentane) to form an ester (ethyl pentanoate) and water. The reaction is driven forward by the removal of water from the reaction mixture, either by distillation or by using a drying agent. The esterification reaction is an important process in organic chemistry and has many applications in industry. It is used to produce a wide range of esters, which are used as solvents, flavorings, and fragrances. The reaction is also used in the synthesis of pharmaceuticals, polymers, and other organic compounds. Overall, the esterification reaction between pentane and ethanol is a key process in organic chemistry. It allows for the production of a variety of esters, which have numerous applications in industry and everyday life.
Adi S.
The following information is given for n-pentane at 1 atm: Tb = 36.20°C, ΔHvap(36.20°C) = 357.6 J/g Tm = -129.70°C, ΔHfus(-129.70°C) = 116.7 J/g Specific heat gas = 1.650 J/g °C Specific heat liquid = 2.280 J/g °C A 47.00 g sample of liquid n-pentane is initially at -84.20°C. If the sample is heated at constant pressure (P = 1 atm), ____ kJ of energy are needed to raise the temperature of the sample to 56.90°C.
Recommended Textbooks
Chemistry: Structure and Properties
Chemistry The Central Science
Chemistry
Transcript
18,000,000+
Students on Numerade
Trusted by students at 8,000+ universities
Watch the video solution with this free unlock.
EMAIL
PASSWORD