Consider each of the following physical characteristics of...

Consider each of the following physical characteristics of certain amides. a. Carboxamides have rotational barriers on the order of $20 \mathrm{kcal} / \mathrm{mol}$ for the process: <smiles>[R]C(=O)N(C)C</smiles> <smiles>C=CC(=O)N(C)CC(=O)c1ccccc1</smiles> Develop a structural explanation for the barrier both in resonance and MO terminology.

Consider each of the following physical characteristics of certain amides.
a. Carboxamides have rotational barriers on the order of $20 \mathrm{kcal} / \mathrm{mol}$ for the process:
<smiles>[R]C(=O)N(C)C</smiles>
<smiles>C=CC(=O)N(C)CC(=O)c1ccccc1</smiles>
Develop a structural explanation for the barrier both in resonance and MO terminology.

Key Concepts

Amide Resonance

In amides, the lone pair on the nitrogen atom can delocalize into the carbonyl ? system, creating a resonance structure in which the C–N bond exhibits partial double-bond character. This resonance stabilization renders the bond less flexible and restricts free rotation. As a consequence, any rotation that disrupts the resonance delocalization comes with a significant energetic cost, explaining the high barrier observed.

Partial Double Bond Character and Planarity

The delocalization of the nitrogen’s lone pair into the carbonyl group gives the C–N bond a partial double bond character, which enforces a planar geometry around the amide group. This planarity is crucial for maintaining effective p orbital overlap needed for resonance. Twisting the bond away from this planar arrangement interferes with the orbital overlap, dramatically reducing resonance stabilization and leading to the high energy rotational barrier.

Molecular Orbital Interactions

From an MO perspective, the nitrogen’s nonbonding orbital (n) interacts with the carbonyl’s ?* (antibonding) orbital. This n to ?* donation stabilizes the system by lowering the energy of the bonding molecular orbitals. Disruption of this interaction by bond rotation raises the energy of the system because the stabilization afforded by the orbital overlap is lost, thereby accounting for the significant rotational barrier observed in amides.

Transcript

Please give Ace some feedback