The unsaturated compound which gives OHC-CH(CH3)-CH2-CH(CH3)-CHO as the product of reductive ozo

step 1 In this problem, I can write the reaction as, just look at it carefully. Here it is CH3 and in t

The unsaturated compound which gives...

The unsaturated compound which gives $\mathrm{OHC}-\mathrm{CH}\left(\mathrm{CH}_{3}\right)-\mathrm{CH}_{2}-\mathrm{CH}\left(\mathrm{CH}_{3}\right)-\mathrm{CHO}$ as the product of reductive ozonolysis is
(a)
(b)
(c)
(d)

Key Concepts

Retrosynthetic Analysis

Retrosynthetic analysis is a problem solving technique used in organic synthesis where the target molecule is deconstructed into simpler precursor structures. In the context of ozonolysis, one examines the products (for instance, carbonyl compounds like aldehydes) to infer the location and type of double bonds in the original unsaturated molecule, thereby identifying the appropriate precursor structure.

Reductive Workup in Ozonolysis

Following the initial formation of the ozonide intermediate during ozonolysis, a reductive workup is performed. This treatment with a reducing agent, such as zinc/acetic acid or dimethyl sulfide, converts the intermediate to stable carbonyl compounds rather than over?oxidizing them. It ensures that functional groups like aldehydes are formed cleanly without further oxidation to carboxylic acids.

Ozonolysis Reaction

Ozonolysis is a chemical reaction that involves the addition of ozone (O?) to carbon–carbon double bonds, leading to the cleavage of these bonds to produce carbonyl compounds. In this process, the unsaturated portion of the molecule is broken at the double bond, and the resulting fragments are typically aldehydes or ketones, depending on their substitution pattern.

Double Bond Cleavage

The foundation of the reaction is the breaking of the carbon–carbon double bond. This cleavage occurs when ozone reacts with the alkene to form an unstable intermediate (molozonide and then ozonide) which subsequently decomposes to yield two separate fragments. Each fragment contains a carbonyl group when the reaction is conducted under appropriate conditions.

Please give Ace some feedback