Home
Ask directory
Chemistry 102
January 2024
31
Chemistry 102
Q&A Archive of
January 31, 2024
Select Question
January 31 of 2024
Calculate ?Hvap for ethanol, given vapor pressure at 40 °C = 150 torr. The normal boiling point for ethanol is 78 °C.
Calculate ?Hvap for ethanol, given vapor pressure at 40 °C = 150 torr. The normal boiling point for ethanol is 78 °C. 1. What is the problem asking you to calculate? 2. What data are you given to solve this problem? 3. What equation do you need to solve the problem?
Heating Curve and Clausius-Clayperon Equation Calculate the total amount of heat absorbed (in kJ) when 2.00 mol of ice at -30.0°C is converted to steam at 140.0°C. Specific heat (J/g °C ): ice, 2.108; water, 4.184; steam, 1.87 ?Hfus = 6.010 kJ/mol; ?Hvap = 40.7 kJ/mol 1. Draw and label aā¦
A given reaction 2 A + B --> products has a measured rate law rate = k[A][B]2 What is the overall order of the reaction 0 1 2 3
Ca(C2H3O2)2+Na2CO3ā>CaCO3+NaC2H3O2
A 50.00 g sample of a solid is placed into a graduated cylinder and then the cylinder is filled to the 100 mL mark with code Res Mountain Dew (density = 1.04 g/mL). The mass of the Code Red and solid together is 141.94 g. Assuming the solid is insoluble in the Code Red, calculate the density inā¦
Four spectra from samples labelled ( A, B, C ), and ( D ) are shown below. The spectra are drawn on the same graph and on the same scale as a function of absorption vs frequency. Each sample produces only one signal (spectral line) in the displayed range. Which sample has the shortest lifetimeā¦
a. Which compound has the strongest intermolecular attractive forces? b. Which compound is the least volatile? c. Which compound has the highest boiling point?
Consider "Particle in a Box" model with a 3D box of dimensions \( 1^{\prime} 2^{\prime \prime} 4 \mathrm{~nm} \). Assuming the energy of the ground level is \( \mathrm{E}_{\mathrm{G}} \), what is the energy of the first excited level? \( 1.14 \mathrm{E}_{\mathrm{G}} \) \( 1.57ā¦
tetrafluorocubane point group
9) The triene shown there rescts with 2 equivilerta of maleic anhydride to yeld a product with the licimis fredict os shockine for the croduct showing steps to generation of the product. Nicte that there ace 2 conseciative addition. (PakaNo Pass) \[ \longrightarrow \mathrm{C}_{12}ā¦
The triene shown here reacts with 2 equivalents of maleic anhydride to yield a product with the
Calculate the heat of formation of hydrazine. 68. In World War II, the Germans made use of otherwise unusable airplane parts by grinding them up into powdered aluminum. This was made to react with ammonium nitrate to produce powerful bombs. The products of this reaction were nitrogen gas,ā¦
In spectroscopy, energy of the electromagnetic radiation can be expressed using various units, including units of energy, frequency, or wavenumbers. From the list below, select radiation with the highest energy of a photon. ( 10 mathrm{~cm}^{-1} ) ( 10 mathrm{meV} ) ( 10 mathrm{~kJ} /ā¦
Select correct point symmetry group for the molecule shown below. Assume all bonds are equal in length and angles between adjacent bonds are 90Āŗ. C4 C4v C4h D4 D4h D4d
51. Glucose, \( \mathrm{C}_{6} \mathrm{H}_{12} \mathrm{O}_{6}(s),\left(\Delta H_{\mathrm{f}}{ }^{\circ}=-1275.2 \mathrm{~kJ} / \mathrm{mol}\right) \) is converted to ethyl alcohol, \( \mathrm{C}_{2} \mathrm{H}_{5} \mathrm{OH}(l) \), and carbon dioxide in the fermentation of grape juice. Whatā¦
51. Glucose, \( \mathrm{C}_{6} \mathrm{H}_{12} \mathrm{O}_{6}(s),\left(\Delta H_{\mathrm{f}}{ }^{\circ}=-1275.2 \mathrm{~kJ} / \mathrm{mol}\right) \) is converted to ethyl alcohol, \( \mathrm{C}_{2} \mathrm{H}_{5} \mathrm{OH}(l) \), and carbon dioxide in the fermentation of grape juice. Whatā¦
Consider the conjugated system of double bonds in the molecule of lycopene \( \left(\mathrm{C}_{40} \mathrm{H}_{56}\right. \), shown below; it makes tomatoes red) as a "Particles in 1D Box" system with the mobile p-electrons acting as the "Particles". Deduce the value of the appropriate quantumā¦
How much of K2SO4 should be weighed to prepare 2.5 L of K2SO4 solution with the K+ concentration of 0.8 mg/mL? Please present the result in grams with accuracy of 1 mg. E.g. if the result is 7.3458273 g, please present it as 7.346 g. Be sure you present the result with units!
In 1962 , radiation from a neutron star was detected with the energy of \( \sim 4 \mathrm{keV} \). It was the first time a radiation in this range of EMS was ever detected from outside of the Solar System. What part of EMS was this signal? Radio waves Microwaves IR Visible UV X-Rays or g-rays
Two spectral lines are expected to appear at the frequencies of \( 5.71^{8} \) and \( 6.410^{8} \mathrm{MHz} \) in an absorption spectrum. Assuming the lifetime of the system in any of the two excited states producing the lines is about \( 1 \mathrm{fs} \), how well will the lines beā¦
plot a graph of mass of sulphur IV oxide against temperature
Select correct point symmetry group for the molecule shown below. Assume all bonds are equal in length and angles between adjacent bonds are 90°.
Consider "Particle in a Box" model with a 3D box of dimensions 1Ć2Ć4 nm. Assuming the energy of the ground level is EG, what is the energy of the first excited level? 1.14 EG 1.57 EG 2 EG 3.29 EG 4 EG
Consider 'Particle in a 3D Box' model, where the particle is a helium atom. How many freedom degrees does the particle possess?
determine fs° and Y for one heterotrophic bacterium that grows on glucose oxidation, when NOg is the electron acceptor and the N source, E= 0.6.
Nitrification is carried out by autotrophs that utilize ammonium as the electron donor, oxygen as the electron acceptor, ammomium as the nitrogen source, and inorganic carbon as the carbon source. Assume ε=0.6. compute the changes to fs0 and Y if the nitrifying bacteria were able to useā¦
a sample of an oxide of copper was found to have 0.300 mole if copper and 0.150 mole of O. What is the oxide's formula?
what is the characters of covalent compound
Four spectra from samples labelled A, B, C, and D are shown below. The spectra are drawn on the same graph and on the same scale as a function of absorption vs frequency. Each sample produces only one signal (spectral line) in the displayed range. Which sample absorbs photons of the highestā¦
2- An aqueous sucrose solution freezes at - 0.31°C. Calculate the molality of the solution and also its boiling point. Given that Kr = 1.86° and Kb = 0.51° for water.
The solubility of pure oxygen in water at ( 20.0^{circ} mathrm{C} ) and 760 torr is ( 4.30 imes 10^{-3} mathrm{~g} mathrm{O}_{2} ) per liter ( mathrm{H}_{2} mathrm{O} ). When air is in contact with water and the air pressure is 620 torr at ( 20.0^{circ} mathrm{C} ), how many grams of oxygenā¦
Calculate the delta Tf for Hg2(NO3)2? The freezing point of a .10m solution of mercury(I) nitrate is approximately -0.27 degrees Celsius
Your answer is incorrect. What is suggested by a van't Hoff factor of approximately 0.5 ? Hint
What is the van't Hoff factor? The product of the actual measure value of a colligative property to the value of the colligative property in the absence of any solute dissociation. The ratio of the actual measure value of a colligative property to the value of the colligative property in theā¦
Coordination number For the complex [Ni(NO2)4]2-
What is the expected freezing point of a 0.10m aqueous solution of mercury(I) Nitrate with a molecular formula of HgNO3? (Assume complete dissociation.)
What is the expected freezing point of a 0.10 m aqueous solution of Mercury(I) nitrate? (Assume complete dissociation.)
What is the expected freezing point of a 0.10m aqueous solution of HgNO3? (Assume complete dissociation.)
What is the expected freezing point of a 0.75 m aqueous solution of CaCl2? (Assume complete dissociation.) °C
What is the osmotic pressure, in torr, of a 8.00% solution of NaCl in water when the temperature of the solution is 45 °C? Enter your answer scientific notation.
Pentane ( left(mathrm{C}_{5} mathrm{H}_{12} ight) ) and heptane ( left(mathrm{C}_{7} mathrm{H}_{16} ight) ) are two hydrocarbon liquids present in gasoline. At ( 20^{circ} mathrm{C} ), the vapor pressure of pentane is 422 torr and the vapor pressure of heptane is 36.0 torr. What will be theā¦
At 25 °C the vapor pressures of benzene (C6H6) and toluene (C7H8) are 93.4 and 26.9 torr, respectively. A solution made by mixing 87.0 g of benzene and 88.0 g of toluene is prepared. At what applied pressure, in torr, will this solution boil?
The freezing point of a ( 0.10 mathrm{~m} ) solution of mercury ( (mathrm{I}) ) nitrate is approximately ( -0.27^{circ} mathrm{C} ) (Assuming that the person who prepared the solution thought it was ( mathrm{HgNO}_{3} ) ). Why do these data suggest that the formula of the mercury ( (mathrm{I})ā¦
The vapor pressure of water at 20.0 °C is 17.5 torr. At that temperature, what would be the vapor pressure of a solution made by dissolving 23.0 g of NaCl in 0.100 kg of water? (Assume complete dissociation of the solute and an ideal solution.) Part 1 Your answer is correct. Recall theā¦
when 0.5 ml tertiary butyl alcohol is reacted with 4.5 ml ammonium chloride and 4.5 ml ammonium bromide in the presence of 1 ml of sulfuric acid. what is major product?
1) Methanol, CH3OH, which is used as a fuel in racing cars and in fuel cells, can be made by reacting carbon monoxide and hydrogen. The balanced reaction is: CO(g) + 2H2(g) -> CH3OH(l) Suppose 356 grams of carbon monoxide and 65.0 grams of hydrogen gas are mixed and allowed to react. Whichā¦
Metallic nickel crystallizes in a face-centered cubic lattice, with one Ni atom per lattice point. If the metallic radius of Ni is 124.6 pm, what is the volume of the unit cell? (a) in pm3 (b) in cm3
The solubility of methane, the chief component of natural gas, in water at 20.0 °C and 1.0 atm pressure is 0.025 g L?¹. What is its solubility in water at 1.5 atm and 20.0 °C? Part 1 Identify the appropriate equation for Henry's Law. C?P? = C?P? C?/P? = C?/P? Cgas = kHPgas C?C? = P?P?
Identify the appropriate equation for Henry's Law. ( C_{1}P_{1}=C_{2}P_{2} ) ( frac{C_{1}}{P_{1}}=frac{C_{2}}{P_{2}} ) ( C_{gas}=k_{H}P_{gas} ) ( C_{1}C_{2}=P_{1}P_{2} )
19. The concentration of hydrogen peroxide in an antiseptic solution was determined by titration with 0.0200 M potassium permanganate solution. 20.00 mL of the peroxide solution was diluted to 250.0 mL. 20.00 mL aliquots of the diluted solution were acidified and titrated with the potassiumā¦
If a saturated solution of \( \mathrm{NH}_{4} \mathrm{NO}_{3} \) at \( 70{ }^{\circ} \mathrm{C} \) is cooled to \( 20^{\circ} \mathrm{C} \), how many grams of solute will separate if the quantity of the solvent is \( 146 \mathrm{~g} \) ? (Use the data below.) Round your answer to threeā¦
The solubility of pure oxygen in water at ( 20.0^{circ} mathrm{C} ) and 760 torr is ( 4.30 imes 10^{-3} mathrm{~g} mathrm{O}_{2} ) per liter ( mathrm{H}_{2} mathrm{O} ). When air is in contact with water and the air pressure is 620 torr at ( 20.0^{circ} mathrm{C} ), how many grams of oxygenā¦
A gas has following composition by weight: C 90%, H2-3.5%, 02-30% N2 1.0%, S 0.5% and remaining Ash. Estimate the minimum mass of air required for complete combustion of 1 kg of fuel if 50% excess air is supply.
a solution of na2co3 is prepared by dissolving 0.21g of sodium carbonate and diluting to 100ml. calculate the normality: if it is used as a dibasic acid
The combustion of methanol is described in the following equation: CH3OH(l) + O2(g) Ć CO2(g) + H2O(l) Calculate the enthalpy of combustion (āHc) of methanol using the values of standard enthalpies of formation (āHf).
a solution of na2co3 is prepared by dissolving 0.21g of sodium carbonate and diluting to 100ml. calculate the normality: if it is used as a dibasic acid
a solution of na2co3 is prepared by dissolving 0.21g of sodium carbonate and diluting to 100ml. calculate the normality: if it is used as a dibasic acid
a solution of na2co3 is prepared by dissolving 0.21g of sodium carbonate and diluting to 100ml. calculate the normality: if it is used as a dibasic acid
a solution of Na2CO3 is prepared by dissolving 0.21g of sodium carbonate and diluting to 100ml. calculate the normality: if it is used as a monobasic acid
LEARNING ACTIVITY 4 ILLUSTRATE AND COMPARE!Given the data on the table choose one of your family member, and on your own understanding, try to illustrate using adjective words separately the words written in the box. Compare your answer with your chosen family member. Write your answer on theā¦
Given the data on the table choose one of your family member and on your own understanding try to illustrate using adjectives words separetely the words written on the box, compare your answers with your chosen family member
what do you think will happen if the substances does not follow kinetic molecular theory
Below is diagram of the mitochondrial electron transport chain: Arrows indicate the direction of electron flow between the components of this chain Identify each lettered item by filling in the blanks below the diagram: A D B Fumarate C. D. E. F. G. H, Discuss the function of Rubisco. Below isā¦
Classify each pair of compounds as either identical, constitutional isomers, stereoisomers, or not isomers.
a b and c
Draw both chair conformers for the following molecule and circle the most stable conformation.
a b c d
10. The reaction: 2A + B ? C has the experimentally determined rate law Rate = k[A][B]². A suggested mechanism is: Step 1: A + B ? D (fast equilibrium) Step 2: D + B ? E Step 3: E + A ? C + B If step 2 is the rate-determining step, is this an acceptable mechanism? (Hint: a reaction mechanismā¦
what will be [NOBr] after 12 seconds?
a and b
7. Give the IUPAC name for each molecule (10 points; 5 points each) a. b.
at first-order reaction is 45.0% complete in 65 seconds. what is a half-life for this reaction?
a, b, and c
a,b & c
rate law and value of the rate
a & b
a,b
a,b,c
1. Draw the resonance structures for the following molecules and draw the resonance hybrid (10 points; 5 points each) a. b.
12. Isomerism: Classify each pair of compounds below as either identical molecules, or constitutional isomers, or stereoisomers, or not isomers of each other. Place one of the following letter designations on the line beside each pair: I = identical C = constitutional isomers S =ā¦
Question 61 (4 points) The table below provides information about the mineral composition of four rocks. Two of the rocks are ingeous and two of the rocks are sedimentary. Based on the information in the table, which igneous rock is mafic and which is felsic? Which sedimentary rock most likelyā¦
11. Cyclohexane Conformation Analysis a. Draw the conformers for the cyclohexane compound shown below (ignore the S). Please draw your structures carefully-poorly drawn structures will receive minimal credit. b. Circle the most stable conformer. Explain why it is the most stable conformer.
10. Label the electrophilic (E+) and/or nucleophilic (Nu-) site in the molecule shown below. Use an arrow and label the site E+ or Nu-.
Label the correct term for the following seismogram: A - B - C. D - E -
6. Draw the product of the proton transfer reaction. Label the acid and base in the starting materials, and the conjugate acid and base in the products. CH3COOH + CH3ONa ?
In chicken, the Leghorn variety has white feathers due to an autosomal dominant allele. Silkies have white feathers due to a recessive allele in a second (different) gene. Assume the chickens in the parental generation are homozygous for the white allele at one gene and homozygous for theā¦
I need help with b and c
calculate the heat absorb when 46.0g of ice at -10.0 C is converted to liquid water at 85.0 C. the specific heat of ice us 2.03 J(gC), the molar heat of fusion of ice is 6010 J/mol, and the specific heat of water is 4.18 J(g C)
Part A Identify the phase(s) present at each point on the diagram. Match the items in the left column to the appropriate blanks in the sentences on the right. gas solid supercritical fluid solid-liquid-gas equilibrium liquid-gas equilibrium liquid solid-liquid equilibrium At point a, a [ ]ā¦
How much heat (in kJ) is evolved in converting 2.00 mol of steam at 139 °C to ice at -45 °C? The heat capacity of steam is 2.01 J/(g · °C), and that one of ice is 2.09 J/(g · °C). Express your answer in kilojoules to three significant figures. |q_total| = kJ
MISSED THIS? Watch KCV 11.5, IWE 11.5; Read Section 11.5. You can click on the Review link to access the section in your eText. Ethanol has a heat of vaporization of 38.56 kJ/mol and a normal boiling point of 78.4 °C. Part A What is the vapor pressure of ethanol at 17 °C? Express your answer inā¦
If the aluminum block is initially at 25 °C, what is the final temperature of the block after the evaporation of the alcohol? Assume that the heat required for the vaporization of the alcohol comes only from the aluminum block and that the alcohol vaporizes at 25 °C. The heat of vaporization ofā¦
b. Name the compound below:
4. What is the molecular mass of benzaldehyde and dibenzalacetone. Show the calculation involved, with reaction.
why did the experiment not get 100% recovery explain where the missing mass could havebeen found
The boiling point of liquid A is 75.5 °C at 1 atm (760.0 torr). Its vapor pressure at 15.5 °C is 205 torr. What is its āHvap in kJ/mol?
A 110.1 gram sample of an unknown substance (MM = 189.50 g/mol) is cooled from 233.0 °C to 147.6 °C. (heat capacity of liquid = 1.62 J/gd °C; heat capacity of gas = 1.04 J/gd °C; āHvap = 78.11 kJ/mol; normal boiling point, Tb = 160.3 °C) How much energy (in kJ) is absorbed/released to coolā¦
Another method of preparing food samples for mineral testing involves dissolving the organic material with acid instead of burning it off through the washing process if you had used the acid procedure do you think your results for the inorganic mineral tests would have been any different?
4. If 0.7534 grams of BaSO4(s) are produced in the above reaction, how many grams of alum must have reacted? If this alum was originally contained in 1.4021 grams of a mixture of NaCl and alum, what was the mass percent of alum in the mixture?
b) Consider following two paths for the preparation of methylene chloride. Path I : [ mathrm{CH}_{4}(mathrm{~g})+2 mathrm{Cl}_{2}(mathrm{~g}) ightarrow mathrm{CH}_{2} mathrm{Cl}_{2}(mathrm{~g})+2 mathrm{HCl}(mathrm{g}) quad Delta mathrm{H}_{1}=-202.3 mathrm{~kJ} ] Path IIā¦
Chemical reactions happen due to collisions between reacting particles. The frequency of the collision determines the speed of reaction from starting point to equilibrium. Explain in detail, the factors that affect the rate of reaction.
Isomers of bromopentane that exists as enantiomers
Name this compound:
If 24.6 mL of a Ca(OH)2 solution are added to neutralize 14.2 mL of 0.0140 M HC2H3O2, what is the molarity of the Ca(OH)2 solution use correct number of significant figures
create a purpose statement for the experiment: Synthesis of Soap / Study of Mixtures, using this explanation. Soap is the result of a process called āsaponification,ā which is the alkaline hydrolysis of fatty acid esters. When fatty acid esters react with alkali metal hydroxides, the esterā¦
How much water must be added to make 2.5 L of a 2 M solution of HCl from 16 M HCl?
create a purpose statement: Soap is the result of a process called āsaponification,ā which is the alkaline hydrolysis of fatty acid esters. When fatty acid esters (ātriglycerideā or ātriacylglycerolā) react with alkali metal hydroxides, the ester bond is cleaved to produce glycerol (a typeā¦
FACULTY OF SCIENCE DEPARTMENT OF CHEMISTRY CONTINUOUS ASSESSMENT CHFM \( 425-2023 / 2024 \) Time: \( 1 \mathrm{H}: 20 \mathrm{~min} \) INSTRUCTIONS: Attempt all questions separately PART 1 (te Marks) 1) Deseribe the structure of lithium nitrite and explain how it is able to function as aā¦
84.7g per day of a certain industrial waste chemical P arrives at a treatment plant settling pond with a volume of 10000 m^3 . P is destroyed by sunlight, and once in the pond it has a half-life of 19 hr . Calculate the equilibrium concentration of in the pond. Round your answer to ā¦
When a certain solid dissolves in water, the solution becomes cool. Is ?Hsoln for this solute positive or negative? Select the single best answer. Negative, because the temperature of the solution dropped. Positive, because as the solution forms, heat is absorbed. Negative, because as theā¦
which of the following statement does not true describe the reaction N2+3H2 2NH3
For an ionic compound dissolving in water, ?Hsoln = -56 kJ mol-1 and the hydration energy is -894 kJ mol-1. Estimate the lattice energy of the ionic compound. lattice energy = 838 kJ mol-1 Hint Lattice energy is a fairly large negative energy term. Subtracting it from the hydration energy ofā¦
For an ionic compound dissolving in water, ?Hsoln = -56 kJ mol-1 and the hydration energy is -894 kJ mol-1. Estimate the lattice energy of the ionic compound. Lattice energy = kJ mol-1 Hint Lattice energy is a fairly large negative energy term. Subtracting it from the hydration energy of theā¦
Which substances will be soluble in non-polar benzene? naphthalene, C10H8 a trans-fat, trans-oleic acid (shown below) hexane potassium bromide
determine the mass in grams of the food dye per one serving of the drink: 35ml per serving -sports drink: grape gatorade - the food dye: 20ppm Red 40 -obtained absorbance of sport drink at Ī»max: 0.165nm - table: concentration: absorbance: 0.000 ppm -0.005nm, 1.998ppm 0.069nm, 3.996 ppmā¦
Table I. The Effect of Temperature on the Reaction Rate of KI and (NH4)2S208.
How does temperature affect solubility in liquid solvents? Solids are less soluble in liquids at high temperature. Gases are more soluble in liquids at high temperature. Solids are more soluble in liquids at high temperature. Gases are less soluble in liquids at high temperature.
determine the concentration of the food dye in the sports drink based on the data given: -sports drink: grape gatorade - the food dye: 6ppm blue 1 -obtained absorbance of sport drink at Ī»max: 0.231 - table: concentration: ppm absorbance: nm 0.000 ā¦
Which factors affect solubility? Pressure Volume Color Polarity Temperature
Which concentration units do not change with temperature? molarity mole fraction density molality mass percent
What concentration unit is used for each type of problem? Boiling point elevation? Vapor pressure lowering? Freezing point depression? Osmotic pressure?
PL 10.1 1. The rate law for the reaction: A + B ā 2C is found by experiment to be: Rate = k [A][B]^2 A. What is the overall order of the reaction, based on its rate law? B. If graphs are drawn of ln[A], 1/[A], ln[B], and 1/[B] versus time, which graphs should be linear? Explain yourā¦
PL 6.2 2.In the following redox reaction: ClO2-1 (aq) + N2H4 (g) ā NO (g) + Cl2 (g) A. What is reduced? B. What is the reducing agent? C. How many moles of water are involved in the balanced equation for this reaction in basic conditions?
PL 6.1 1. What is the oxidation number (state) of chlorine in the following chemical species: A. NaCl B. Mg(ClO4)2 C. HClO D. Al(ClO3)3
the molecules of a certain gas sample have a RMS speed of 261m/s calculate the most probable speed
7.5 Sort the following chemical species (1-4) by reducing power: Al(s) Ag(s) Zn(s) Mg(s)
7.4: Sort the following chemical species (1-4) by oxidizing power: Na+ Ca2+ Mg2+ Al3+
7.3 Decide whether a chemical reaction happens in either of the following situations. If a reaction does happen, write the chemical equation for it. Be sure your chemical equation is balanced and has physical state symbols Situation A: A strip of solid lead metal is put into a beaker ofā¦
7.2 Decide whether a chemical reaction happens in either of the following situations. If a reaction does happen, write the chemical equation for it. Be sure your chemical equation is balanced and has physical state symbols. Situation A: A strip of solid lead metal is put into a beaker ofā¦
7.1 Suppose the galvanic cell in the picture attached is powered by the following reaction: Fe(s)+CuNO32(aq)ā FeNO32(aq)+Cu(s) Write a balanced equation for the half-reaction that happens at the cathode of this cell. Write a balanced equation for the half-reaction that happens at the anode ofā¦
6.15 Write a balanced half-reaction for the oxidation of aqueous hydrogen peroxide to gaseous oxygen in acidic aqueous solution. Be sure to add physical state symbols where appropriate.
6.14 Write balanced half-reactions for the following redox reaction: Cu2+(aq)+NO2(g)+2OHā(aq)ā Cu+(aq)+NOā3(aq)+H2O(l) reduction: oxidation:
6.13 Write balanced half-reactions for the following redox reaction: H3AsO4(aq)+4H2O(l)+8Fe2+(aq)ā AsH3(g)+8OHā(aq)+8Fe3+(aq) reduction: oxidation:
6.12 Write balanced half-reactions for the following redox reaction: BiOā3(aq)+6H+(aq)+Zn(s)ā Bi3+(aq)+3H2O(l)+Zn2+(aq) reduction: oxidation:
6.11 Write balanced half-reactions for the following redox reaction: 2CO2(g)+12H+(aq)+6C2O2ā4(aq)ā C2H5OH(l)+3H2O(l)+12CO2(aq)
6.10 Write balanced half-reactions for the following redox reaction: Cl2(g)+Bi3+(aq)+6OHā(aq)ā 2Clā(aq)+BiOā3(aq)+3H2O(l)
6.9 Balance the following redox reaction in basic solution. Brā(aq)+CrO2ā(aq)ā Br2(l)+CrOH3(s)
6.8 Balance the following redox reaction in basic solution. Brā(aq)+H2O(l)ā Br2(l)+H2(g)
6.7 Balance the following redox reaction in acidic solution. Clā(aq)+HNO2(aq)ā Cl2(g)+NO(g)
6.6 Balance the following redox reaction in acidic solution. Mn2+(aq)+Br2(l)ā MnO2(s)+Brā(aq)
6.5 Balance the following redox reaction in acidic solution. H2O(l)+Cl2(g)ā O2(g)+Clā(aq)
6.4 Write a balanced half-reaction for the oxidation of manganese ion to solid manganese dioxide in basic aqueous solution. Be sure to add physical state symbols where appropriate.
6.3 Write a balanced half-reaction for the reduction of gaseous oxygen to liquid water in basic aqueous solution. Be sure to add physical state symbols where appropriate.
Part B Complete the sentences to best explain the ranking. Match the words in the left column to the appropriate blanks in the sentences on the right. Make certain each sentence is complete before submitting your answer. hydrogen bonding a less polar bond dipole-dipole forces strongerā¦
6.2 Write a balanced half-reaction for the reduction of permanganate ion to solid manganese dioxide in acidic aqueous solution. Be sure to add physical state symbols where appropriate.
question in picture
P_4(s) + 6 H_2(g) ---> 4 PH_3(g)? what is true about the reaction of deltaG
7. Name the following compounds a. MgO b. Cas k. \( \mathrm{HClO}_{3} \) c. Pobit L. HO, a. PbO, m. \( \mathrm{H}_{\mathrm{m}} \mathrm{O} \), e. Lif a. \( \mathrm{KNO}_{3} \) ?. No, g. \( \mathrm{KNO}_{2} \) a. \( \mathrm{CCl}_{4} \) h. \( \mathrm{Na}_{3} \mathrm{PO}_{3} \) q. \( \mathrm{P}_{2}ā¦
Balance equation: D. MnO4^1- (aq) + HS^1- (aq) = S (s) + MnO2 (s) (basic solution)
a standard olympic size swimming pool is 50
Calculate ?Hvap for ethanol, given vapor pressure at 40 °C = 150 torr. The normal boiling point for ethanol is 78 °C.
Calculate ?Hvap for ethanol, given vapor pressure at 40 °C = 150 torr. The normal boiling point for ethanol is 78 °C. 1. What is the problem asking you to calculate? 2. What data are you given to solve this problem? 3. What equation do you need to solve the problem?
Heating Curve and Clausius-Clayperon Equation Calculate the total amount of heat absorbed (in kJ) when 2.00 mol of ice at -30.0°C is converted to steam at 140.0°C. Specific heat (J/g °C ): ice, 2.108; water, 4.184; steam, 1.87 ?Hfus = 6.010 kJ/mol; ?Hvap = 40.7 kJ/mol 1. Draw and label aā¦
A given reaction 2 A + B --> products has a measured rate law rate = k[A][B]2 What is the overall order of the reaction 0 1 2 3
Ca(C2H3O2)2+Na2CO3ā>CaCO3+NaC2H3O2
Four spectra from samples labelled ( A, B, C ), and ( D ) are shown below. The spectra are drawn on the same graph and on the same scale as a function of absorption vs frequency. Each sample produces only one signal (spectral line) in the displayed range. Which sample has the shortest lifetimeā¦
a. Which compound has the strongest intermolecular attractive forces? b. Which compound is the least volatile? c. Which compound has the highest boiling point?
In spectroscopy, energy of the electromagnetic radiation can be expressed using various units, including units of energy, frequency, or wavenumbers. From the list below, select radiation with the highest energy of a photon. ( 10 mathrm{~cm}^{-1} ) ( 10 mathrm{meV} ) ( 10 mathrm{~kJ} /ā¦
Select correct point symmetry group for the molecule shown below. Assume all bonds are equal in length and angles between adjacent bonds are 90Āŗ. C4 C4v C4h D4 D4h D4d
How much of K2SO4 should be weighed to prepare 2.5 L of K2SO4 solution with the K+ concentration of 0.8 mg/mL? Please present the result in grams with accuracy of 1 mg. E.g. if the result is 7.3458273 g, please present it as 7.346 g. Be sure you present the result with units!
Select correct point symmetry group for the molecule shown below. Assume all bonds are equal in length and angles between adjacent bonds are 90°.
Consider "Particle in a Box" model with a 3D box of dimensions 1Ć2Ć4 nm. Assuming the energy of the ground level is EG, what is the energy of the first excited level? 1.14 EG 1.57 EG 2 EG 3.29 EG 4 EG
Consider 'Particle in a 3D Box' model, where the particle is a helium atom. How many freedom degrees does the particle possess?
Four spectra from samples labelled A, B, C, and D are shown below. The spectra are drawn on the same graph and on the same scale as a function of absorption vs frequency. Each sample produces only one signal (spectral line) in the displayed range. Which sample absorbs photons of the highestā¦
The solubility of pure oxygen in water at ( 20.0^{circ} mathrm{C} ) and 760 torr is ( 4.30 imes 10^{-3} mathrm{~g} mathrm{O}_{2} ) per liter ( mathrm{H}_{2} mathrm{O} ). When air is in contact with water and the air pressure is 620 torr at ( 20.0^{circ} mathrm{C} ), how many grams of oxygenā¦
Calculate the delta Tf for Hg2(NO3)2? The freezing point of a .10m solution of mercury(I) nitrate is approximately -0.27 degrees Celsius
Your answer is incorrect. What is suggested by a van't Hoff factor of approximately 0.5 ? Hint
What is the van't Hoff factor? The product of the actual measure value of a colligative property to the value of the colligative property in the absence of any solute dissociation. The ratio of the actual measure value of a colligative property to the value of the colligative property in theā¦
Coordination number For the complex [Ni(NO2)4]2-
What is the expected freezing point of a 0.10m aqueous solution of mercury(I) Nitrate with a molecular formula of HgNO3? (Assume complete dissociation.)
What is the expected freezing point of a 0.10 m aqueous solution of Mercury(I) nitrate? (Assume complete dissociation.)
What is the expected freezing point of a 0.10m aqueous solution of HgNO3? (Assume complete dissociation.)
What is the expected freezing point of a 0.75 m aqueous solution of CaCl2? (Assume complete dissociation.) °C
What is the osmotic pressure, in torr, of a 8.00% solution of NaCl in water when the temperature of the solution is 45 °C? Enter your answer scientific notation.
Pentane ( left(mathrm{C}_{5} mathrm{H}_{12} ight) ) and heptane ( left(mathrm{C}_{7} mathrm{H}_{16} ight) ) are two hydrocarbon liquids present in gasoline. At ( 20^{circ} mathrm{C} ), the vapor pressure of pentane is 422 torr and the vapor pressure of heptane is 36.0 torr. What will be theā¦
At 25 °C the vapor pressures of benzene (C6H6) and toluene (C7H8) are 93.4 and 26.9 torr, respectively. A solution made by mixing 87.0 g of benzene and 88.0 g of toluene is prepared. At what applied pressure, in torr, will this solution boil?
The freezing point of a ( 0.10 mathrm{~m} ) solution of mercury ( (mathrm{I}) ) nitrate is approximately ( -0.27^{circ} mathrm{C} ) (Assuming that the person who prepared the solution thought it was ( mathrm{HgNO}_{3} ) ). Why do these data suggest that the formula of the mercury ( (mathrm{I})ā¦
The vapor pressure of water at 20.0 °C is 17.5 torr. At that temperature, what would be the vapor pressure of a solution made by dissolving 23.0 g of NaCl in 0.100 kg of water? (Assume complete dissociation of the solute and an ideal solution.) Part 1 Your answer is correct. Recall theā¦
1) Methanol, CH3OH, which is used as a fuel in racing cars and in fuel cells, can be made by reacting carbon monoxide and hydrogen. The balanced reaction is: CO(g) + 2H2(g) -> CH3OH(l) Suppose 356 grams of carbon monoxide and 65.0 grams of hydrogen gas are mixed and allowed to react. Whichā¦
The solubility of methane, the chief component of natural gas, in water at 20.0 °C and 1.0 atm pressure is 0.025 g L?¹. What is its solubility in water at 1.5 atm and 20.0 °C? Part 1 Identify the appropriate equation for Henry's Law. C?P? = C?P? C?/P? = C?/P? Cgas = kHPgas C?C? = P?P?
Identify the appropriate equation for Henry's Law. ( C_{1}P_{1}=C_{2}P_{2} ) ( frac{C_{1}}{P_{1}}=frac{C_{2}}{P_{2}} ) ( C_{gas}=k_{H}P_{gas} ) ( C_{1}C_{2}=P_{1}P_{2} )
19. The concentration of hydrogen peroxide in an antiseptic solution was determined by titration with 0.0200 M potassium permanganate solution. 20.00 mL of the peroxide solution was diluted to 250.0 mL. 20.00 mL aliquots of the diluted solution were acidified and titrated with the potassiumā¦
The solubility of pure oxygen in water at ( 20.0^{circ} mathrm{C} ) and 760 torr is ( 4.30 imes 10^{-3} mathrm{~g} mathrm{O}_{2} ) per liter ( mathrm{H}_{2} mathrm{O} ). When air is in contact with water and the air pressure is 620 torr at ( 20.0^{circ} mathrm{C} ), how many grams of oxygenā¦
Classify each pair of compounds as either identical, constitutional isomers, stereoisomers, or not isomers.
a b and c
Draw both chair conformers for the following molecule and circle the most stable conformation.
a b c d
10. The reaction: 2A + B ? C has the experimentally determined rate law Rate = k[A][B]². A suggested mechanism is: Step 1: A + B ? D (fast equilibrium) Step 2: D + B ? E Step 3: E + A ? C + B If step 2 is the rate-determining step, is this an acceptable mechanism? (Hint: a reaction mechanismā¦
what will be [NOBr] after 12 seconds?
a and b
7. Give the IUPAC name for each molecule (10 points; 5 points each) a. b.
at first-order reaction is 45.0% complete in 65 seconds. what is a half-life for this reaction?
a, b, and c
a,b & c
rate law and value of the rate
a & b
a,b
a,b,c
1. Draw the resonance structures for the following molecules and draw the resonance hybrid (10 points; 5 points each) a. b.
12. Isomerism: Classify each pair of compounds below as either identical molecules, or constitutional isomers, or stereoisomers, or not isomers of each other. Place one of the following letter designations on the line beside each pair: I = identical C = constitutional isomers S =ā¦
11. Cyclohexane Conformation Analysis a. Draw the conformers for the cyclohexane compound shown below (ignore the S). Please draw your structures carefully-poorly drawn structures will receive minimal credit. b. Circle the most stable conformer. Explain why it is the most stable conformer.
10. Label the electrophilic (E+) and/or nucleophilic (Nu-) site in the molecule shown below. Use an arrow and label the site E+ or Nu-.
6. Draw the product of the proton transfer reaction. Label the acid and base in the starting materials, and the conjugate acid and base in the products. CH3COOH + CH3ONa ?
I need help with b and c
Part A Identify the phase(s) present at each point on the diagram. Match the items in the left column to the appropriate blanks in the sentences on the right. gas solid supercritical fluid solid-liquid-gas equilibrium liquid-gas equilibrium liquid solid-liquid equilibrium At point a, a [ ]ā¦
How much heat (in kJ) is evolved in converting 2.00 mol of steam at 139 °C to ice at -45 °C? The heat capacity of steam is 2.01 J/(g · °C), and that one of ice is 2.09 J/(g · °C). Express your answer in kilojoules to three significant figures. |q_total| = kJ
MISSED THIS? Watch KCV 11.5, IWE 11.5; Read Section 11.5. You can click on the Review link to access the section in your eText. Ethanol has a heat of vaporization of 38.56 kJ/mol and a normal boiling point of 78.4 °C. Part A What is the vapor pressure of ethanol at 17 °C? Express your answer inā¦
If the aluminum block is initially at 25 °C, what is the final temperature of the block after the evaporation of the alcohol? Assume that the heat required for the vaporization of the alcohol comes only from the aluminum block and that the alcohol vaporizes at 25 °C. The heat of vaporization ofā¦
b. Name the compound below:
The boiling point of liquid A is 75.5 °C at 1 atm (760.0 torr). Its vapor pressure at 15.5 °C is 205 torr. What is its āHvap in kJ/mol?
A 110.1 gram sample of an unknown substance (MM = 189.50 g/mol) is cooled from 233.0 °C to 147.6 °C. (heat capacity of liquid = 1.62 J/gd °C; heat capacity of gas = 1.04 J/gd °C; āHvap = 78.11 kJ/mol; normal boiling point, Tb = 160.3 °C) How much energy (in kJ) is absorbed/released to coolā¦
4. If 0.7534 grams of BaSO4(s) are produced in the above reaction, how many grams of alum must have reacted? If this alum was originally contained in 1.4021 grams of a mixture of NaCl and alum, what was the mass percent of alum in the mixture?
b) Consider following two paths for the preparation of methylene chloride. Path I : [ mathrm{CH}_{4}(mathrm{~g})+2 mathrm{Cl}_{2}(mathrm{~g}) ightarrow mathrm{CH}_{2} mathrm{Cl}_{2}(mathrm{~g})+2 mathrm{HCl}(mathrm{g}) quad Delta mathrm{H}_{1}=-202.3 mathrm{~kJ} ] Path IIā¦
Chemical reactions happen due to collisions between reacting particles. The frequency of the collision determines the speed of reaction from starting point to equilibrium. Explain in detail, the factors that affect the rate of reaction.
If 24.6 mL of a Ca(OH)2 solution are added to neutralize 14.2 mL of 0.0140 M HC2H3O2, what is the molarity of the Ca(OH)2 solution use correct number of significant figures
create a purpose statement for the experiment: Synthesis of Soap / Study of Mixtures, using this explanation. Soap is the result of a process called āsaponification,ā which is the alkaline hydrolysis of fatty acid esters. When fatty acid esters react with alkali metal hydroxides, the esterā¦
How much water must be added to make 2.5 L of a 2 M solution of HCl from 16 M HCl?
When a certain solid dissolves in water, the solution becomes cool. Is ?Hsoln for this solute positive or negative? Select the single best answer. Negative, because the temperature of the solution dropped. Positive, because as the solution forms, heat is absorbed. Negative, because as theā¦
For an ionic compound dissolving in water, ?Hsoln = -56 kJ mol-1 and the hydration energy is -894 kJ mol-1. Estimate the lattice energy of the ionic compound. lattice energy = 838 kJ mol-1 Hint Lattice energy is a fairly large negative energy term. Subtracting it from the hydration energy ofā¦
For an ionic compound dissolving in water, ?Hsoln = -56 kJ mol-1 and the hydration energy is -894 kJ mol-1. Estimate the lattice energy of the ionic compound. Lattice energy = kJ mol-1 Hint Lattice energy is a fairly large negative energy term. Subtracting it from the hydration energy of theā¦
Which substances will be soluble in non-polar benzene? naphthalene, C10H8 a trans-fat, trans-oleic acid (shown below) hexane potassium bromide
determine the mass in grams of the food dye per one serving of the drink: 35ml per serving -sports drink: grape gatorade - the food dye: 20ppm Red 40 -obtained absorbance of sport drink at Ī»max: 0.165nm - table: concentration: absorbance: 0.000 ppm -0.005nm, 1.998ppm 0.069nm, 3.996 ppmā¦
How does temperature affect solubility in liquid solvents? Solids are less soluble in liquids at high temperature. Gases are more soluble in liquids at high temperature. Solids are more soluble in liquids at high temperature. Gases are less soluble in liquids at high temperature.
determine the concentration of the food dye in the sports drink based on the data given: -sports drink: grape gatorade - the food dye: 6ppm blue 1 -obtained absorbance of sport drink at Ī»max: 0.231 - table: concentration: ppm absorbance: nm 0.000 ā¦
Which factors affect solubility? Pressure Volume Color Polarity Temperature
Which concentration units do not change with temperature? molarity mole fraction density molality mass percent
What concentration unit is used for each type of problem? Boiling point elevation? Vapor pressure lowering? Freezing point depression? Osmotic pressure?
PL 10.1 1. The rate law for the reaction: A + B ā 2C is found by experiment to be: Rate = k [A][B]^2 A. What is the overall order of the reaction, based on its rate law? B. If graphs are drawn of ln[A], 1/[A], ln[B], and 1/[B] versus time, which graphs should be linear? Explain yourā¦
PL 6.2 2.In the following redox reaction: ClO2-1 (aq) + N2H4 (g) ā NO (g) + Cl2 (g) A. What is reduced? B. What is the reducing agent? C. How many moles of water are involved in the balanced equation for this reaction in basic conditions?
PL 6.1 1. What is the oxidation number (state) of chlorine in the following chemical species: A. NaCl B. Mg(ClO4)2 C. HClO D. Al(ClO3)3
7.5 Sort the following chemical species (1-4) by reducing power: Al(s) Ag(s) Zn(s) Mg(s)
7.4: Sort the following chemical species (1-4) by oxidizing power: Na+ Ca2+ Mg2+ Al3+
7.3 Decide whether a chemical reaction happens in either of the following situations. If a reaction does happen, write the chemical equation for it. Be sure your chemical equation is balanced and has physical state symbols Situation A: A strip of solid lead metal is put into a beaker ofā¦
7.2 Decide whether a chemical reaction happens in either of the following situations. If a reaction does happen, write the chemical equation for it. Be sure your chemical equation is balanced and has physical state symbols. Situation A: A strip of solid lead metal is put into a beaker ofā¦
7.1 Suppose the galvanic cell in the picture attached is powered by the following reaction: Fe(s)+CuNO32(aq)ā FeNO32(aq)+Cu(s) Write a balanced equation for the half-reaction that happens at the cathode of this cell. Write a balanced equation for the half-reaction that happens at the anode ofā¦
6.15 Write a balanced half-reaction for the oxidation of aqueous hydrogen peroxide to gaseous oxygen in acidic aqueous solution. Be sure to add physical state symbols where appropriate.
6.14 Write balanced half-reactions for the following redox reaction: Cu2+(aq)+NO2(g)+2OHā(aq)ā Cu+(aq)+NOā3(aq)+H2O(l) reduction: oxidation:
6.13 Write balanced half-reactions for the following redox reaction: H3AsO4(aq)+4H2O(l)+8Fe2+(aq)ā AsH3(g)+8OHā(aq)+8Fe3+(aq) reduction: oxidation:
6.12 Write balanced half-reactions for the following redox reaction: BiOā3(aq)+6H+(aq)+Zn(s)ā Bi3+(aq)+3H2O(l)+Zn2+(aq) reduction: oxidation:
6.11 Write balanced half-reactions for the following redox reaction: 2CO2(g)+12H+(aq)+6C2O2ā4(aq)ā C2H5OH(l)+3H2O(l)+12CO2(aq)
6.10 Write balanced half-reactions for the following redox reaction: Cl2(g)+Bi3+(aq)+6OHā(aq)ā 2Clā(aq)+BiOā3(aq)+3H2O(l)
6.9 Balance the following redox reaction in basic solution. Brā(aq)+CrO2ā(aq)ā Br2(l)+CrOH3(s)
6.8 Balance the following redox reaction in basic solution. Brā(aq)+H2O(l)ā Br2(l)+H2(g)
6.7 Balance the following redox reaction in acidic solution. Clā(aq)+HNO2(aq)ā Cl2(g)+NO(g)
6.6 Balance the following redox reaction in acidic solution. Mn2+(aq)+Br2(l)ā MnO2(s)+Brā(aq)
6.5 Balance the following redox reaction in acidic solution. H2O(l)+Cl2(g)ā O2(g)+Clā(aq)
6.4 Write a balanced half-reaction for the oxidation of manganese ion to solid manganese dioxide in basic aqueous solution. Be sure to add physical state symbols where appropriate.
6.3 Write a balanced half-reaction for the reduction of gaseous oxygen to liquid water in basic aqueous solution. Be sure to add physical state symbols where appropriate.
Part B Complete the sentences to best explain the ranking. Match the words in the left column to the appropriate blanks in the sentences on the right. Make certain each sentence is complete before submitting your answer. hydrogen bonding a less polar bond dipole-dipole forces strongerā¦
6.2 Write a balanced half-reaction for the reduction of permanganate ion to solid manganese dioxide in acidic aqueous solution. Be sure to add physical state symbols where appropriate.
question in picture
P_4(s) + 6 H_2(g) ---> 4 PH_3(g)? what is true about the reaction of deltaG
Balance equation: D. MnO4^1- (aq) + HS^1- (aq) = S (s) + MnO2 (s) (basic solution)
a standard olympic size swimming pool is 50