Identify the correct equation for the equilibrium constant $K_a$ for the weak acid dissociation of acetic acid.\ $HC_2H_3O_2 (aq) + H_2O (l) ightleftharpoons H_3O^+ (aq) + C_2H_3O_2^-(aq)$ Select one: $K_a = frac{[H_3O^+][C_2H_3O_2^-]}{[HC_2H_3O_2][H_2O]}$ $K_a = frac{[HC_2H_3O_2]}{[H_3O^+][C_2H_3O_2^-]}$ $K_a = frac{[HC_2H_3O_2][H_2O]}{[H_3O^+][C_2H_3O_2^-]}$ $K_a = frac{[H_3O^+][C_2H_3O_2^-]}{[HC_2H_3O_2]}$
Added by John S.
Close
Step 1
First, let's rewrite the given equation with the correct symbols: $$ CH_3COOH \, (aq) + H_2O \, (l) \rightleftharpoons H_3O^+ \, (aq) + CH_3COO^- \, (aq) $$ Now, let's write the expression for the equilibrium constant, Ka: $$ K_a = Show more…
Show all steps
Your feedback will help us improve your experience
Adi S and 86 other Chemistry 101 educators are ready to help you.
Ask a new question
Labs
Want to see this concept in action?
Explore this concept interactively to see how it behaves as you change inputs.
Key Concepts
Recommended Videos
Identify the correct equation for the equilibrium constant Ka for the weak acid dissociation of acetic acid. HC2H3O2 (aq) + H2O (l) = H3O+ (aq) + C2H3O2- (aq)
Adi S.
Identify the correct equation for the equilibrium constant Ka for the weak acid dissociation of acetic acid. HC2H3O2(aq) + H2O(l) ⇌ H3O+(aq) + C2H3O2-(aq) Select one: Ka = [HC2H3O2]/[H3O+][C2H3O2-] Ka = [HC2H3O2][H2O]/[H3O+][C2H3O2-] Ka = [H3O+][C2H3O2-]/[HC2H3O2] Ka = [H3O+][C2H3O2-]/[HC2H3O2][H2O]
Supreeta N.
The dissociation formula for acetic acid is: HC2H3O2(aq) + H2O(l) <-> H3O+(aq) + C2H3O2-(aq) The reaction of ammonia with water is: NH3(aq) + H2O(l) <-> NH4+(aq) + OH-(aq) Match the correct equation for the equilibrium constant. Acetic acid Ka = Ammonia Kb =
Sri K.
Recommended Textbooks
Chemistry: Structure and Properties
Chemistry The Central Science
Chemistry
Transcript
Watch the video solution with this free unlock.
EMAIL
PASSWORD